C17H15N3O4 — CID 90556498
ethyl 5-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]pyrazolo[1,5-a]pyridine-3-carboxylate (PubChem CID 90556498) has the molecular formula C17H15N3O4 and a molecular weight of 325.32 g/mol. Its IUPAC name is ethyl 5-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]pyrazolo[1,5-a]pyridine-3-carboxylate.
| Compound Name | ethyl 5-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]pyrazolo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 90556498 |
| Molecular Formula | C17H15N3O4 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | ethyl 5-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]pyrazolo[1,5-a]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnn2ccc(NC(=O)/C=C/c3ccco3)cc12 |
| InChI | InChI=1S/C17H15N3O4/c1-2-23-17(22)14-11-18-20-8-7-12(10-15(14)20)19-16(21)6-5-13-4-3-9-24-13/h3-11H,2H2,1H3,(H,19,21)/b6-5+ |
| InChIKey | JMUGRSBXVSAPQS-AATRIKPKSA-N |
| XLogP | 2.76 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|