C17H23N3O3 — CID 90558113
N'-cyclopropyl-N-[2-(2,3-dihydro-1-benzofuran-5-yl)-2-(dimethylamino)ethyl]oxamide (PubChem CID 90558113) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is N'-cyclopropyl-N-[2-(2,3-dihydro-1-benzofuran-5-yl)-2-(dimethylamino)ethyl]oxamide.
| Compound Name | N'-cyclopropyl-N-[2-(2,3-dihydro-1-benzofuran-5-yl)-2-(dimethylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 90558113 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | N'-cyclopropyl-N-[2-(2,3-dihydro-1-benzofuran-5-yl)-2-(dimethylamino)ethyl]oxamide |
| SMILES | CN(C)C(CNC(=O)C(=O)NC1CC1)c1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C17H23N3O3/c1-20(2)14(10-18-16(21)17(22)19-13-4-5-13)11-3-6-15-12(9-11)7-8-23-15/h3,6,9,13-14H,4-5,7-8,10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | DVXDROGZLATBGN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|