C14H14N2O4 — CID 90558308
N-[2-(furan-3-yl)ethyl]-2-(4-nitrophenyl)acetamide (PubChem CID 90558308) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is N-[2-(furan-3-yl)ethyl]-2-(4-nitrophenyl)acetamide.
| Compound Name | N-[2-(furan-3-yl)ethyl]-2-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 90558308 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | N-[2-(furan-3-yl)ethyl]-2-(4-nitrophenyl)acetamide |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)NCCc1ccoc1 |
| InChI | InChI=1S/C14H14N2O4/c17-14(15-7-5-12-6-8-20-10-12)9-11-1-3-13(4-2-11)16(18)19/h1-4,6,8,10H,5,7,9H2,(H,15,17) |
| InChIKey | CEVFCHXCZDZTLV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|