C16H21N3O2 — CID 90559367
cyclohex-3-en-1-yl-(4-pyridazin-3-yloxypiperidin-1-yl)methanone (PubChem CID 90559367) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is cyclohex-3-en-1-yl-(4-pyridazin-3-yloxypiperidin-1-yl)methanone.
| Compound Name | cyclohex-3-en-1-yl-(4-pyridazin-3-yloxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 90559367 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | cyclohex-3-en-1-yl-(4-pyridazin-3-yloxypiperidin-1-yl)methanone |
| SMILES | O=C(C1CC=CCC1)N1CCC(Oc2cccnn2)CC1 |
| InChI | InChI=1S/C16H21N3O2/c20-16(13-5-2-1-3-6-13)19-11-8-14(9-12-19)21-15-7-4-10-17-18-15/h1-2,4,7,10,13-14H,3,5-6,8-9,11-12H2 |
| InChIKey | DJQQPOXSWVVXQI-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|