C14H22N4O4S — CID 90559659
N-methyl-N-[2-[4-(6-methylpyridazin-3-yl)oxypiperidin-1-yl]-2-oxoethyl]methanesulfonamide (PubChem CID 90559659) has the molecular formula C14H22N4O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is N-methyl-N-[2-[4-(6-methylpyridazin-3-yl)oxypiperidin-1-yl]-2-oxoethyl]methanesulfonamide.
| Compound Name | N-methyl-N-[2-[4-(6-methylpyridazin-3-yl)oxypiperidin-1-yl]-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 90559659 |
| Molecular Formula | C14H22N4O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-methyl-N-[2-[4-(6-methylpyridazin-3-yl)oxypiperidin-1-yl]-2-oxoethyl]methanesulfonamide |
| SMILES | Cc1ccc(OC2CCN(C(=O)CN(C)S(C)(=O)=O)CC2)nn1 |
| InChI | InChI=1S/C14H22N4O4S/c1-11-4-5-13(16-15-11)22-12-6-8-18(9-7-12)14(19)10-17(2)23(3,20)21/h4-5,12H,6-10H2,1-3H3 |
| InChIKey | QLSKJHSORRFMBP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |