C24H26N4O3 — CID 90560568
methyl 4-[4-[2-(2-phenylimidazol-1-yl)ethyl]piperazine-1-carbonyl]benzoate (PubChem CID 90560568) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is methyl 4-[4-[2-(2-phenylimidazol-1-yl)ethyl]piperazine-1-carbonyl]benzoate.
| Compound Name | methyl 4-[4-[2-(2-phenylimidazol-1-yl)ethyl]piperazine-1-carbonyl]benzoate |
|---|---|
| PubChem CID | 90560568 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | methyl 4-[4-[2-(2-phenylimidazol-1-yl)ethyl]piperazine-1-carbonyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCN(CCn3ccnc3-c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H26N4O3/c1-31-24(30)21-9-7-20(8-10-21)23(29)28-17-14-26(15-18-28)13-16-27-12-11-25-22(27)19-5-3-2-4-6-19/h2-12H,13-18H2,1H3 |
| InChIKey | YEIXJZFUACCGEY-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |