About [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone
[4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone (PubChem CID 90561451) has the molecular formula C15H21N5O2
and a molecular weight of 303.37 g/mol. Its IUPAC name is [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone.
Molecular Properties
| Compound Name | [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone |
| PubChem CID | 90561451 |
| Molecular Formula | C15H21N5O2 |
| Molecular Weight | 303.37 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone |
| SMILES | CCc1nccn1CCN1CCN(C(=O)c2ccno2)CC1 |
| InChI | InChI=1S/C15H21N5O2/c1-2-14-16-5-6-19(14)10-7-18-8-11-20(12-9-18)15(21)13-3-4-17-22-13/h3-6H,2,7-12H2,1H3 |
| InChIKey | NYQMBKROXLJYNT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 67.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone?
The IUPAC name of [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone (CID 90561451) is [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone.
What is the SMILES notation for [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone?
The canonical SMILES for [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone is CCc1nccn1CCN1CCN(C(=O)c2ccno2)CC1.
What is the InChIKey of [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone?
The InChIKey is NYQMBKROXLJYNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N5O2/c1-2-14-16-5-6-19(14)10-7-18-8-11-20(12-9-18)15(21)13-3-4-17-22-13/h3-6H,2,7-12H2,1H3.
What are the key properties of [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone?
[4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone has a molecular weight of 303.37 g/mol, XLogP of 0.89, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-(2-ethylimidazol-1-yl)ethyl]piperazin-1-yl]-(1,2-oxazol-5-yl)methanone is sourced from PubChem (CID 90561451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).