C19H17Cl2N3O3 — CID 9056246
(3R)-N'-(4-chlorobenzoyl)-1-(3-chloro-2-methylphenyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 9056246) has the molecular formula C19H17Cl2N3O3 and a molecular weight of 406.27 g/mol. Its IUPAC name is (3R)-N'-(4-chlorobenzoyl)-1-(3-chloro-2-methylphenyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | (3R)-N'-(4-chlorobenzoyl)-1-(3-chloro-2-methylphenyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 9056246 |
| Molecular Formula | C19H17Cl2N3O3 |
| Molecular Weight | 406.27 g/mol |
| Exact Mass | 405.06 |
| IUPAC Name | (3R)-N'-(4-chlorobenzoyl)-1-(3-chloro-2-methylphenyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | Cc1c(Cl)cccc1N1C[C@H](C(=O)NNC(=O)c2ccc(Cl)cc2)CC1=O |
| InChI | InChI=1S/C19H17Cl2N3O3/c1-11-15(21)3-2-4-16(11)24-10-13(9-17(24)25)19(27)23-22-18(26)12-5-7-14(20)8-6-12/h2-8,13H,9-10H2,1H3,(H,22,26)(H,23,27)/t13-/m1/s1 |
| InChIKey | UNWKLQBUENHLCO-CYBMUJFWSA-N |
| XLogP | 3.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.27 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|