C21H13F3N4O2 — CID 90562645
2,3,4-trifluoro-N-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]benzamide (PubChem CID 90562645) has the molecular formula C21H13F3N4O2 and a molecular weight of 410.36 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]benzamide |
|---|---|
| PubChem CID | 90562645 |
| Molecular Formula | C21H13F3N4O2 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2,3,4-trifluoro-N-[2-[(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1Cc1nc(-c2cccnc2)no1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C21H13F3N4O2/c22-15-8-7-14(18(23)19(15)24)21(29)26-16-6-2-1-4-12(16)10-17-27-20(28-30-17)13-5-3-9-25-11-13/h1-9,11H,10H2,(H,26,29) |
| InChIKey | NAOQLCADJNUGPX-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|