C23H22N4O2S — CID 90563896
1-(3-phenylpropyl)-3-[2-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]urea (PubChem CID 90563896) has the molecular formula C23H22N4O2S and a molecular weight of 418.52 g/mol. Its IUPAC name is 1-(3-phenylpropyl)-3-[2-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]urea.
| Compound Name | 1-(3-phenylpropyl)-3-[2-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]urea |
|---|---|
| PubChem CID | 90563896 |
| Molecular Formula | C23H22N4O2S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 1-(3-phenylpropyl)-3-[2-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]phenyl]urea |
| SMILES | O=C(NCCCc1ccccc1)Nc1ccccc1Cc1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C23H22N4O2S/c28-23(24-14-6-10-17-8-2-1-3-9-17)25-19-12-5-4-11-18(19)16-21-26-22(27-29-21)20-13-7-15-30-20/h1-5,7-9,11-13,15H,6,10,14,16H2,(H2,24,25,28) |
| InChIKey | RHSAHPGHZLYCCK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|