About 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone
2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone (PubChem CID 90565534) has the molecular formula C17H21N5O2S
and a molecular weight of 359.46 g/mol. Its IUPAC name is 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone.
Molecular Properties
| Compound Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone |
| PubChem CID | 90565534 |
| Molecular Formula | C17H21N5O2S |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone |
| SMILES | Cn1nnnc1SCC(=O)N1CCC2(CCc3ccccc3O2)CC1 |
| InChI | InChI=1S/C17H21N5O2S/c1-21-16(18-19-20-21)25-12-15(23)22-10-8-17(9-11-22)7-6-13-4-2-3-5-14(13)24-17/h2-5H,6-12H2,1H3 |
| InChIKey | ZDPGZNWVGPSGME-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone?
The IUPAC name of 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone (CID 90565534) is 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone.
What is the SMILES notation for 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone?
The canonical SMILES for 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone is Cn1nnnc1SCC(=O)N1CCC2(CCc3ccccc3O2)CC1.
What is the InChIKey of 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone?
The InChIKey is ZDPGZNWVGPSGME-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O2S/c1-21-16(18-19-20-21)25-12-15(23)22-10-8-17(9-11-22)7-6-13-4-2-3-5-14(13)24-17/h2-5H,6-12H2,1H3.
What are the key properties of 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone?
2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone has a molecular weight of 359.46 g/mol, XLogP of 1.69, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methyltetrazol-5-yl)sulfanyl-1-spiro[3,4-dihydrochromene-2,4'-piperidine]-1'-ylethanone is sourced from PubChem (CID 90565534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).