C16H21N3O3 — CID 90567826
1-(oxan-4-yl)-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide (PubChem CID 90567826) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 1-(oxan-4-yl)-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(oxan-4-yl)-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90567826 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 1-(oxan-4-yl)-5-oxo-N-(pyridin-2-ylmethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccccn1)C1CC(=O)N(C2CCOCC2)C1 |
| InChI | InChI=1S/C16H21N3O3/c20-15-9-12(11-19(15)14-4-7-22-8-5-14)16(21)18-10-13-3-1-2-6-17-13/h1-3,6,12,14H,4-5,7-11H2,(H,18,21) |
| InChIKey | TUFLWADNQIAFTK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |