C20H27N3O3S — CID 90568232
2-[4-[3-[(dimethylamino)methyl]-1,4-thiazepan-4-yl]-4-oxobutyl]isoindole-1,3-dione (PubChem CID 90568232) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 2-[4-[3-[(dimethylamino)methyl]-1,4-thiazepan-4-yl]-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[3-[(dimethylamino)methyl]-1,4-thiazepan-4-yl]-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90568232 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-[4-[3-[(dimethylamino)methyl]-1,4-thiazepan-4-yl]-4-oxobutyl]isoindole-1,3-dione |
| SMILES | CN(C)CC1CSCCCN1C(=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C20H27N3O3S/c1-21(2)13-15-14-27-12-6-11-22(15)18(24)9-5-10-23-19(25)16-7-3-4-8-17(16)20(23)26/h3-4,7-8,15H,5-6,9-14H2,1-2H3 |
| InChIKey | MTMWRWPAZRMTDN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|