About 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide
3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide (PubChem CID 90569484) has the molecular formula C13H16ClN3O
and a molecular weight of 265.74 g/mol. Its IUPAC name is 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide.
Molecular Properties
| Compound Name | 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide |
| PubChem CID | 90569484 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide |
| SMILES | CC(C)(CCl)C(=O)NCc1cc2ccccn2n1 |
| InChI | InChI=1S/C13H16ClN3O/c1-13(2,9-14)12(18)15-8-10-7-11-5-3-4-6-17(11)16-10/h3-7H,8-9H2,1-2H3,(H,15,18) |
| InChIKey | HHLACIBLRFVULC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide?
The IUPAC name of 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide (CID 90569484) is 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide.
What is the SMILES notation for 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide?
The canonical SMILES for 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide is CC(C)(CCl)C(=O)NCc1cc2ccccn2n1.
What is the InChIKey of 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide?
The InChIKey is HHLACIBLRFVULC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16ClN3O/c1-13(2,9-14)12(18)15-8-10-7-11-5-3-4-6-17(11)16-10/h3-7H,8-9H2,1-2H3,(H,15,18).
What are the key properties of 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide?
3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide has a molecular weight of 265.74 g/mol, XLogP of 2.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2,2-dimethyl-N-(pyrazolo[1,5-a]pyridin-2-ylmethyl)propanamide is sourced from PubChem (CID 90569484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).