C12H14N4O — CID 90569707
1-prop-2-enyl-3-(pyrazolo[1,5-a]pyridin-2-ylmethyl)urea (PubChem CID 90569707) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is 1-prop-2-enyl-3-(pyrazolo[1,5-a]pyridin-2-ylmethyl)urea.
| Compound Name | 1-prop-2-enyl-3-(pyrazolo[1,5-a]pyridin-2-ylmethyl)urea |
|---|---|
| PubChem CID | 90569707 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-prop-2-enyl-3-(pyrazolo[1,5-a]pyridin-2-ylmethyl)urea |
| SMILES | C=CCNC(=O)NCc1cc2ccccn2n1 |
| InChI | InChI=1S/C12H14N4O/c1-2-6-13-12(17)14-9-10-8-11-5-3-4-7-16(11)15-10/h2-5,7-8H,1,6,9H2,(H2,13,14,17) |
| InChIKey | REYCSOHXKYQJGP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|