About ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate
ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate (PubChem CID 90569843) has the molecular formula C15H17N3O3
and a molecular weight of 287.32 g/mol. Its IUPAC name is ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate.
Molecular Properties
| Compound Name | ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate |
| PubChem CID | 90569843 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N(Cc1cnc2ccccn12)C1CC1 |
| InChI | InChI=1S/C15H17N3O3/c1-2-21-15(20)14(19)18(11-6-7-11)10-12-9-16-13-5-3-4-8-17(12)13/h3-5,8-9,11H,2,6-7,10H2,1H3 |
| InChIKey | FDRJKIANGPLXAB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate?
The IUPAC name of ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate (CID 90569843) is ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate.
What is the SMILES notation for ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate?
The canonical SMILES for ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate is CCOC(=O)C(=O)N(Cc1cnc2ccccn12)C1CC1.
What is the InChIKey of ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate?
The InChIKey is FDRJKIANGPLXAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O3/c1-2-21-15(20)14(19)18(11-6-7-11)10-12-9-16-13-5-3-4-8-17(12)13/h3-5,8-9,11H,2,6-7,10H2,1H3.
What are the key properties of ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate?
ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate has a molecular weight of 287.32 g/mol, XLogP of 1.39, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[cyclopropyl(imidazo[1,2-a]pyridin-3-ylmethyl)amino]-2-oxoacetate is sourced from PubChem (CID 90569843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).