About 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide
5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide (PubChem CID 90570305) has the molecular formula C19H14ClN3OS
and a molecular weight of 367.86 g/mol. Its IUPAC name is 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide |
| PubChem CID | 90570305 |
| Molecular Formula | C19H14ClN3OS |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.05 |
| IUPAC Name | 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide |
| SMILES | O=C(c1ccc(Cl)s1)N(Cc1cnc2ccccn12)c1ccccc1 |
| InChI | InChI=1S/C19H14ClN3OS/c20-17-10-9-16(25-17)19(24)23(14-6-2-1-3-7-14)13-15-12-21-18-8-4-5-11-22(15)18/h1-12H,13H2 |
| InChIKey | IKJMAMHJZYJOEJ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide?
The IUPAC name of 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide (CID 90570305) is 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide.
What is the SMILES notation for 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide?
The canonical SMILES for 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide is O=C(c1ccc(Cl)s1)N(Cc1cnc2ccccn12)c1ccccc1.
What is the InChIKey of 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide?
The InChIKey is IKJMAMHJZYJOEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14ClN3OS/c20-17-10-9-16(25-17)19(24)23(14-6-2-1-3-7-14)13-15-12-21-18-8-4-5-11-22(15)18/h1-12H,13H2.
What are the key properties of 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide?
5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide has a molecular weight of 367.86 g/mol, XLogP of 4.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-(imidazo[1,2-a]pyridin-3-ylmethyl)-N-phenylthiophene-2-carboxamide is sourced from PubChem (CID 90570305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).