About N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide
N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide (PubChem CID 90570483) has the molecular formula C16H23N3O
and a molecular weight of 273.38 g/mol. Its IUPAC name is N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide.
Molecular Properties
| Compound Name | N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide |
| PubChem CID | 90570483 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide |
| SMILES | CCC(CC)C(=O)N(CC)Cc1cnc2ccccn12 |
| InChI | InChI=1S/C16H23N3O/c1-4-13(5-2)16(20)18(6-3)12-14-11-17-15-9-7-8-10-19(14)15/h7-11,13H,4-6,12H2,1-3H3 |
| InChIKey | BBXNUPYSXTVMGR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide?
The IUPAC name of N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide (CID 90570483) is N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide.
What is the SMILES notation for N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide?
The canonical SMILES for N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide is CCC(CC)C(=O)N(CC)Cc1cnc2ccccn12.
What is the InChIKey of N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide?
The InChIKey is BBXNUPYSXTVMGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O/c1-4-13(5-2)16(20)18(6-3)12-14-11-17-15-9-7-8-10-19(14)15/h7-11,13H,4-6,12H2,1-3H3.
What are the key properties of N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide?
N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide has a molecular weight of 273.38 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-diethyl-N-(imidazo[1,2-a]pyridin-3-ylmethyl)butanamide is sourced from PubChem (CID 90570483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).