C18H26N4O2S — CID 90571670
2-[(4-cyclohexylsulfonylpiperazin-1-yl)methyl]pyrazolo[1,5-a]pyridine (PubChem CID 90571670) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-[(4-cyclohexylsulfonylpiperazin-1-yl)methyl]pyrazolo[1,5-a]pyridine.
| Compound Name | 2-[(4-cyclohexylsulfonylpiperazin-1-yl)methyl]pyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 90571670 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[(4-cyclohexylsulfonylpiperazin-1-yl)methyl]pyrazolo[1,5-a]pyridine |
| SMILES | O=S(=O)(C1CCCCC1)N1CCN(Cc2cc3ccccn3n2)CC1 |
| InChI | InChI=1S/C18H26N4O2S/c23-25(24,18-7-2-1-3-8-18)21-12-10-20(11-13-21)15-16-14-17-6-4-5-9-22(17)19-16/h4-6,9,14,18H,1-3,7-8,10-13,15H2 |
| InChIKey | UONXEYBUOMWVGO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 57.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |