C19H18BrNO3 — CID 9057289
(4-bromophenyl) (3R)-1-(3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 9057289) has the molecular formula C19H18BrNO3 and a molecular weight of 388.26 g/mol. Its IUPAC name is (4-bromophenyl) (3R)-1-(3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | (4-bromophenyl) (3R)-1-(3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057289 |
| Molecular Formula | C19H18BrNO3 |
| Molecular Weight | 388.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | (4-bromophenyl) (3R)-1-(3,5-dimethylphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | Cc1cc(C)cc(N2C[C@H](C(=O)Oc3ccc(Br)cc3)CC2=O)c1 |
| InChI | InChI=1S/C19H18BrNO3/c1-12-7-13(2)9-16(8-12)21-11-14(10-18(21)22)19(23)24-17-5-3-15(20)4-6-17/h3-9,14H,10-11H2,1-2H3/t14-/m1/s1 |
| InChIKey | YADPIFYCJFONFJ-CQSZACIVSA-N |
| XLogP | 4.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|