C16H21N3O3S2 — CID 90572934
8-tert-butyl-6-oxo-N-(2-oxothiolan-3-yl)-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide (PubChem CID 90572934) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 8-tert-butyl-6-oxo-N-(2-oxothiolan-3-yl)-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide.
| Compound Name | 8-tert-butyl-6-oxo-N-(2-oxothiolan-3-yl)-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 90572934 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 8-tert-butyl-6-oxo-N-(2-oxothiolan-3-yl)-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide |
| SMILES | CC(C)(C)c1cc(=O)n2c(n1)SCC(C(=O)NC1CCSC1=O)C2 |
| InChI | InChI=1S/C16H21N3O3S2/c1-16(2,3)11-6-12(20)19-7-9(8-24-15(19)18-11)13(21)17-10-4-5-23-14(10)22/h6,9-10H,4-5,7-8H2,1-3H3,(H,17,21) |
| InChIKey | VSXPOWRFVRJBKH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|