C13H12N4O3S2 — CID 90573663
N-(4,6-dihydrothieno[3,4-c][1,2]oxazol-3-yl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide (PubChem CID 90573663) has the molecular formula C13H12N4O3S2 and a molecular weight of 336.40 g/mol. Its IUPAC name is N-(4,6-dihydrothieno[3,4-c][1,2]oxazol-3-yl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide.
| Compound Name | N-(4,6-dihydrothieno[3,4-c][1,2]oxazol-3-yl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide |
|---|---|
| PubChem CID | 90573663 |
| Molecular Formula | C13H12N4O3S2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N-(4,6-dihydrothieno[3,4-c][1,2]oxazol-3-yl)-6-oxo-3,4-dihydro-2H-pyrimido[2,1-b][1,3]thiazine-3-carboxamide |
| SMILES | O=C(Nc1onc2c1CSC2)C1CSc2nccc(=O)n2C1 |
| InChI | InChI=1S/C13H12N4O3S2/c18-10-1-2-14-13-17(10)3-7(4-22-13)11(19)15-12-8-5-21-6-9(8)16-20-12/h1-2,7H,3-6H2,(H,15,19) |
| InChIKey | VNHFMFOYFFYVTA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |