C21H22ClNO4 — CID 90574825
N-[4-(2-chlorophenoxy)but-2-ynyl]-3,4-diethoxybenzamide (PubChem CID 90574825) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is N-[4-(2-chlorophenoxy)but-2-ynyl]-3,4-diethoxybenzamide.
| Compound Name | N-[4-(2-chlorophenoxy)but-2-ynyl]-3,4-diethoxybenzamide |
|---|---|
| PubChem CID | 90574825 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[4-(2-chlorophenoxy)but-2-ynyl]-3,4-diethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NCC#CCOc2ccccc2Cl)cc1OCC |
| InChI | InChI=1S/C21H22ClNO4/c1-3-25-19-12-11-16(15-20(19)26-4-2)21(24)23-13-7-8-14-27-18-10-6-5-9-17(18)22/h5-6,9-12,15H,3-4,13-14H2,1-2H3,(H,23,24) |
| InChIKey | MIXBYOVMLXPFDH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|