C19H18N2O5 — CID 90575574
N-[4-(2-methoxyphenoxy)but-2-ynyl]-4-methyl-3-nitrobenzamide (PubChem CID 90575574) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is N-[4-(2-methoxyphenoxy)but-2-ynyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[4-(2-methoxyphenoxy)but-2-ynyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 90575574 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[4-(2-methoxyphenoxy)but-2-ynyl]-4-methyl-3-nitrobenzamide |
| SMILES | COc1ccccc1OCC#CCNC(=O)c1ccc(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18N2O5/c1-14-9-10-15(13-16(14)21(23)24)19(22)20-11-5-6-12-26-18-8-4-3-7-17(18)25-2/h3-4,7-10,13H,11-12H2,1-2H3,(H,20,22) |
| InChIKey | NVJKNLCYHUNGPQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|