C22H25N3O4 — CID 90577466
N-[3-[4-[2-(4-methoxyphenyl)ethylcarbamoylamino]but-2-ynoxy]phenyl]acetamide (PubChem CID 90577466) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is N-[3-[4-[2-(4-methoxyphenyl)ethylcarbamoylamino]but-2-ynoxy]phenyl]acetamide.
| Compound Name | N-[3-[4-[2-(4-methoxyphenyl)ethylcarbamoylamino]but-2-ynoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 90577466 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | N-[3-[4-[2-(4-methoxyphenyl)ethylcarbamoylamino]but-2-ynoxy]phenyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)NCC#CCOc2cccc(NC(C)=O)c2)cc1 |
| InChI | InChI=1S/C22H25N3O4/c1-17(26)25-19-6-5-7-21(16-19)29-15-4-3-13-23-22(27)24-14-12-18-8-10-20(28-2)11-9-18/h5-11,16H,12-15H2,1-2H3,(H,25,26)(H2,23,24,27) |
| InChIKey | CBDQNUXWQLHAJM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|