About N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide (PubChem CID 90577565) has the molecular formula C14H10F2N2O3
and a molecular weight of 292.24 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide |
| PubChem CID | 90577565 |
| Molecular Formula | C14H10F2N2O3 |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide |
| SMILES | O=C(NCC#CCOc1ccc(F)cc1F)c1ccno1 |
| InChI | InChI=1S/C14H10F2N2O3/c15-10-3-4-12(11(16)9-10)20-8-2-1-6-17-14(19)13-5-7-18-21-13/h3-5,7,9H,6,8H2,(H,17,19) |
| InChIKey | IWSRZWYLOISWIY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide?
The IUPAC name of N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide (CID 90577565) is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide.
What is the SMILES notation for N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide?
The canonical SMILES for N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide is O=C(NCC#CCOc1ccc(F)cc1F)c1ccno1.
What is the InChIKey of N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide?
The InChIKey is IWSRZWYLOISWIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2N2O3/c15-10-3-4-12(11(16)9-10)20-8-2-1-6-17-14(19)13-5-7-18-21-13/h3-5,7,9H,6,8H2,(H,17,19).
What are the key properties of N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide?
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide has a molecular weight of 292.24 g/mol, XLogP of 1.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,4-difluorophenoxy)but-2-ynyl]-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 90577565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).