C20H16Cl2N2O3S — CID 90579967
2,4-dichloro-5-methyl-N-(4-quinolin-8-yloxybut-2-ynyl)benzenesulfonamide (PubChem CID 90579967) has the molecular formula C20H16Cl2N2O3S and a molecular weight of 435.33 g/mol. Its IUPAC name is 2,4-dichloro-5-methyl-N-(4-quinolin-8-yloxybut-2-ynyl)benzenesulfonamide.
| Compound Name | 2,4-dichloro-5-methyl-N-(4-quinolin-8-yloxybut-2-ynyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90579967 |
| Molecular Formula | C20H16Cl2N2O3S |
| Molecular Weight | 435.33 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2,4-dichloro-5-methyl-N-(4-quinolin-8-yloxybut-2-ynyl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC#CCOc2cccc3cccnc23)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H16Cl2N2O3S/c1-14-12-19(17(22)13-16(14)21)28(25,26)24-10-2-3-11-27-18-8-4-6-15-7-5-9-23-20(15)18/h4-9,12-13,24H,10-11H2,1H3 |
| InChIKey | SFEAUUPYWAHZBN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|