About methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate
methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate (PubChem CID 90581032) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate.
Molecular Properties
| Compound Name | methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate |
| PubChem CID | 90581032 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate |
| SMILES | COC(=O)NCC1(O)CCc2ccccc2C1 |
| InChI | InChI=1S/C13H17NO3/c1-17-12(15)14-9-13(16)7-6-10-4-2-3-5-11(10)8-13/h2-5,16H,6-9H2,1H3,(H,14,15) |
| InChIKey | WTPGQVSDDJSQSI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate?
The IUPAC name of methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate (CID 90581032) is methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate.
What is the SMILES notation for methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate?
The canonical SMILES for methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate is COC(=O)NCC1(O)CCc2ccccc2C1.
What is the InChIKey of methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate?
The InChIKey is WTPGQVSDDJSQSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-17-12(15)14-9-13(16)7-6-10-4-2-3-5-11(10)8-13/h2-5,16H,6-9H2,1H3,(H,14,15).
What are the key properties of methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate?
methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate has a molecular weight of 235.28 g/mol, XLogP of 1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2-hydroxy-3,4-dihydro-1H-naphthalen-2-yl)methyl]carbamate is sourced from PubChem (CID 90581032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).