C19H24N2O2 — CID 90581411
N-[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]-3,5-dimethylbenzamide (PubChem CID 90581411) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]-3,5-dimethylbenzamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]-3,5-dimethylbenzamide |
|---|---|
| PubChem CID | 90581411 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]-3,5-dimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)NCC(O)c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C19H24N2O2/c1-13-9-14(2)11-16(10-13)19(23)20-12-18(22)15-5-7-17(8-6-15)21(3)4/h5-11,18,22H,12H2,1-4H3,(H,20,23) |
| InChIKey | VMQGGUGVRWFYLN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|