C19H29N3O3 — CID 90581640
N'-cycloheptyl-N-[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]oxamide (PubChem CID 90581640) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is N'-cycloheptyl-N-[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]oxamide.
| Compound Name | N'-cycloheptyl-N-[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]oxamide |
|---|---|
| PubChem CID | 90581640 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | N'-cycloheptyl-N-[2-[4-(dimethylamino)phenyl]-2-hydroxyethyl]oxamide |
| SMILES | CN(C)c1ccc(C(O)CNC(=O)C(=O)NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C19H29N3O3/c1-22(2)16-11-9-14(10-12-16)17(23)13-20-18(24)19(25)21-15-7-5-3-4-6-8-15/h9-12,15,17,23H,3-8,13H2,1-2H3,(H,20,24)(H,21,25) |
| InChIKey | ZMTXUYMYBNGJDU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|