C11H19NO2S — CID 90584231
N-[(3-methoxythiolan-3-yl)methyl]cyclobutanecarboxamide (PubChem CID 90584231) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is N-[(3-methoxythiolan-3-yl)methyl]cyclobutanecarboxamide.
| Compound Name | N-[(3-methoxythiolan-3-yl)methyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 90584231 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-[(3-methoxythiolan-3-yl)methyl]cyclobutanecarboxamide |
| SMILES | COC1(CNC(=O)C2CCC2)CCSC1 |
| InChI | InChI=1S/C11H19NO2S/c1-14-11(5-6-15-8-11)7-12-10(13)9-3-2-4-9/h9H,2-8H2,1H3,(H,12,13) |
| InChIKey | IYNXPOUDTFJBRO-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |