C13H12F2N2 — CID 9058447
N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2,4-difluoroaniline (PubChem CID 9058447) has the molecular formula C13H12F2N2 and a molecular weight of 234.25 g/mol. Its IUPAC name is N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2,4-difluoroaniline.
| Compound Name | N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 9058447 |
| Molecular Formula | C13H12F2N2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | N-[(Z)-[(1R,5R)-6-bicyclo[3.2.0]hept-2-enylidene]amino]-2,4-difluoroaniline |
| SMILES | Fc1ccc(N/N=C2/C[C@@H]3C=CC[C@@H]23)c(F)c1 |
| InChI | InChI=1S/C13H12F2N2/c14-9-4-5-12(11(15)7-9)16-17-13-6-8-2-1-3-10(8)13/h1-2,4-5,7-8,10,16H,3,6H2/b17-13-/t8-,10+/m0/s1 |
| InChIKey | YMTFKWGBSAHLGO-CXLJYZSNSA-N |
| XLogP | 3.33 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|