C20H23NO4S — CID 90584859
1-[3-(benzenesulfonyl)pyrrolidin-1-yl]-2-(4-ethoxyphenyl)ethanone (PubChem CID 90584859) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)pyrrolidin-1-yl]-2-(4-ethoxyphenyl)ethanone.
| Compound Name | 1-[3-(benzenesulfonyl)pyrrolidin-1-yl]-2-(4-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 90584859 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[3-(benzenesulfonyl)pyrrolidin-1-yl]-2-(4-ethoxyphenyl)ethanone |
| SMILES | CCOc1ccc(CC(=O)N2CCC(S(=O)(=O)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-2-25-17-10-8-16(9-11-17)14-20(22)21-13-12-19(15-21)26(23,24)18-6-4-3-5-7-18/h3-11,19H,2,12-15H2,1H3 |
| InChIKey | ZXRBDDXFSOIBQV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |