C17H25NO3S2 — CID 90585164
1-(4-methylsulfonylpiperidin-1-yl)-2-(4-propan-2-ylsulfanylphenyl)ethanone (PubChem CID 90585164) has the molecular formula C17H25NO3S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is 1-(4-methylsulfonylpiperidin-1-yl)-2-(4-propan-2-ylsulfanylphenyl)ethanone.
| Compound Name | 1-(4-methylsulfonylpiperidin-1-yl)-2-(4-propan-2-ylsulfanylphenyl)ethanone |
|---|---|
| PubChem CID | 90585164 |
| Molecular Formula | C17H25NO3S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | 1-(4-methylsulfonylpiperidin-1-yl)-2-(4-propan-2-ylsulfanylphenyl)ethanone |
| SMILES | CC(C)Sc1ccc(CC(=O)N2CCC(S(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C17H25NO3S2/c1-13(2)22-15-6-4-14(5-7-15)12-17(19)18-10-8-16(9-11-18)23(3,20)21/h4-7,13,16H,8-12H2,1-3H3 |
| InChIKey | LHZZSFASXITOBZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |