About 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine
6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine (PubChem CID 90585434) has the molecular formula C9H13N3O2S
and a molecular weight of 227.29 g/mol. Its IUPAC name is 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine |
| PubChem CID | 90585434 |
| Molecular Formula | C9H13N3O2S |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine |
| SMILES | CC(C)S(=O)(=O)N1Cc2cncnc2C1 |
| InChI | InChI=1S/C9H13N3O2S/c1-7(2)15(13,14)12-4-8-3-10-6-11-9(8)5-12/h3,6-7H,4-5H2,1-2H3 |
| InChIKey | VLDPSCBWRHLGHP-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine?
The IUPAC name of 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine (CID 90585434) is 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine?
The canonical SMILES for 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine is CC(C)S(=O)(=O)N1Cc2cncnc2C1.
What is the InChIKey of 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine?
The InChIKey is VLDPSCBWRHLGHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O2S/c1-7(2)15(13,14)12-4-8-3-10-6-11-9(8)5-12/h3,6-7H,4-5H2,1-2H3.
What are the key properties of 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine?
6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine has a molecular weight of 227.29 g/mol, XLogP of 0.53, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-propan-2-ylsulfonyl-5,7-dihydropyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 90585434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).