About N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide
N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide (PubChem CID 90586080) has the molecular formula C19H17ClN2O3
and a molecular weight of 356.81 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide.
Molecular Properties
| Compound Name | N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide |
| PubChem CID | 90586080 |
| Molecular Formula | C19H17ClN2O3 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide |
| SMILES | O=C1CC2(CCN(C(=O)Nc3ccccc3Cl)C2)Oc2ccccc21 |
| InChI | InChI=1S/C19H17ClN2O3/c20-14-6-2-3-7-15(14)21-18(24)22-10-9-19(12-22)11-16(23)13-5-1-4-8-17(13)25-19/h1-8H,9-12H2,(H,21,24) |
| InChIKey | SATSWLDZHDVSNI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide?
The IUPAC name of N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide (CID 90586080) is N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide.
What is the SMILES notation for N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide?
The canonical SMILES for N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide is O=C1CC2(CCN(C(=O)Nc3ccccc3Cl)C2)Oc2ccccc21.
What is the InChIKey of N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide?
The InChIKey is SATSWLDZHDVSNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN2O3/c20-14-6-2-3-7-15(14)21-18(24)22-10-9-19(12-22)11-16(23)13-5-1-4-8-17(13)25-19/h1-8H,9-12H2,(H,21,24).
What are the key properties of N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide?
N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide has a molecular weight of 356.81 g/mol, XLogP of 3.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chlorophenyl)-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-carboxamide is sourced from PubChem (CID 90586080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).