C9H12F5NO3S — CID 90586557
2,2,3,3,3-pentafluoro-1-(4-methylsulfonylpiperidin-1-yl)propan-1-one (PubChem CID 90586557) has the molecular formula C9H12F5NO3S and a molecular weight of 309.26 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-(4-methylsulfonylpiperidin-1-yl)propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-(4-methylsulfonylpiperidin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 90586557 |
| Molecular Formula | C9H12F5NO3S |
| Molecular Weight | 309.26 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-(4-methylsulfonylpiperidin-1-yl)propan-1-one |
| SMILES | CS(=O)(=O)C1CCN(C(=O)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H12F5NO3S/c1-19(17,18)6-2-4-15(5-3-6)7(16)8(10,11)9(12,13)14/h6H,2-5H2,1H3 |
| InChIKey | WLTGLGIWWZJLQO-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|