C19H22N4O5S — CID 90586929
6-(2-methoxyethyl)-5-(3-methylsulfonylpyrrolidine-1-carbonyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one (PubChem CID 90586929) has the molecular formula C19H22N4O5S and a molecular weight of 418.48 g/mol. Its IUPAC name is 6-(2-methoxyethyl)-5-(3-methylsulfonylpyrrolidine-1-carbonyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one.
| Compound Name | 6-(2-methoxyethyl)-5-(3-methylsulfonylpyrrolidine-1-carbonyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
|---|---|
| PubChem CID | 90586929 |
| Molecular Formula | C19H22N4O5S |
| Molecular Weight | 418.48 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 6-(2-methoxyethyl)-5-(3-methylsulfonylpyrrolidine-1-carbonyl)-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaen-2-one |
| SMILES | COCCn1c(C(=O)N2CCC(S(C)(=O)=O)C2)cc2c(=O)n3ccccc3nc21 |
| InChI | InChI=1S/C19H22N4O5S/c1-28-10-9-22-15(19(25)21-8-6-13(12-21)29(2,26)27)11-14-17(22)20-16-5-3-4-7-23(16)18(14)24/h3-5,7,11,13H,6,8-10,12H2,1-2H3 |
| InChIKey | HOHFTDNKOZTHFA-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 102.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.48 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |