C9H10F7NO3S — CID 90586997
2,2,3,3,4,4,4-heptafluoro-1-(3-methylsulfonylpyrrolidin-1-yl)butan-1-one (PubChem CID 90586997) has the molecular formula C9H10F7NO3S and a molecular weight of 345.24 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-(3-methylsulfonylpyrrolidin-1-yl)butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-(3-methylsulfonylpyrrolidin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 90586997 |
| Molecular Formula | C9H10F7NO3S |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 345.03 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-(3-methylsulfonylpyrrolidin-1-yl)butan-1-one |
| SMILES | CS(=O)(=O)C1CCN(C(=O)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H10F7NO3S/c1-21(19,20)5-2-3-17(4-5)6(18)7(10,11)8(12,13)9(14,15)16/h5H,2-4H2,1H3 |
| InChIKey | KWWYRVPRERCUFN-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|