C14H11ClF7NO3S — CID 90587751
1-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-2,2,3,3,4,4,4-heptafluorobutan-1-one (PubChem CID 90587751) has the molecular formula C14H11ClF7NO3S and a molecular weight of 441.75 g/mol. Its IUPAC name is 1-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-2,2,3,3,4,4,4-heptafluorobutan-1-one.
| Compound Name | 1-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-2,2,3,3,4,4,4-heptafluorobutan-1-one |
|---|---|
| PubChem CID | 90587751 |
| Molecular Formula | C14H11ClF7NO3S |
| Molecular Weight | 441.75 g/mol |
| Exact Mass | 441.00 |
| IUPAC Name | 1-[3-(4-chlorophenyl)sulfonylpyrrolidin-1-yl]-2,2,3,3,4,4,4-heptafluorobutan-1-one |
| SMILES | O=C(N1CCC(S(=O)(=O)c2ccc(Cl)cc2)C1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H11ClF7NO3S/c15-8-1-3-9(4-2-8)27(25,26)10-5-6-23(7-10)11(24)12(16,17)13(18,19)14(20,21)22/h1-4,10H,5-7H2 |
| InChIKey | YAHWSMLOASIOCE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.75 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|