C15H16F3N3O — CID 90588560
3,4-dimethyl-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzamide (PubChem CID 90588560) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is 3,4-dimethyl-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzamide.
| Compound Name | 3,4-dimethyl-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 90588560 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 3,4-dimethyl-N-[2-[3-(trifluoromethyl)pyrazol-1-yl]ethyl]benzamide |
| SMILES | Cc1ccc(C(=O)NCCn2ccc(C(F)(F)F)n2)cc1C |
| InChI | InChI=1S/C15H16F3N3O/c1-10-3-4-12(9-11(10)2)14(22)19-6-8-21-7-5-13(20-21)15(16,17)18/h3-5,7,9H,6,8H2,1-2H3,(H,19,22) |
| InChIKey | RDHXENQVTUZTGO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |