About 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione
6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione (PubChem CID 905888) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione.
Molecular Properties
| Compound Name | 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione |
| PubChem CID | 905888 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)OCC2=O |
| InChI | InChI=1S/C10H12O3/c1-10(2)3-6(11)9-7(12)5-13-8(9)4-10/h3-5H2,1-2H3 |
| InChIKey | RXKNYEMNXONBEG-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione?
The IUPAC name of 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione (CID 905888) is 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione.
What is the SMILES notation for 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione?
The canonical SMILES for 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione is CC1(C)CC(=O)C2=C(C1)OCC2=O.
What is the InChIKey of 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione?
The InChIKey is RXKNYEMNXONBEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-10(2)3-6(11)9-7(12)5-13-8(9)4-10/h3-5H2,1-2H3.
What are the key properties of 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione?
6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione has a molecular weight of 180.20 g/mol, XLogP of 1.23, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethyl-5,7-dihydro-1-benzofuran-3,4-dione is sourced from PubChem (CID 905888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).