C13H18F7NO3S — CID 90590166
2,2,3,3,4,4,4-heptafluoro-1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]butan-1-one (PubChem CID 90590166) has the molecular formula C13H18F7NO3S and a molecular weight of 401.34 g/mol. Its IUPAC name is 2,2,3,3,4,4,4-heptafluoro-1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]butan-1-one.
| Compound Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 90590166 |
| Molecular Formula | C13H18F7NO3S |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluoro-1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]butan-1-one |
| SMILES | CC(C)CS(=O)(=O)C1CCN(C(=O)C(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H18F7NO3S/c1-8(2)7-25(23,24)9-3-5-21(6-4-9)10(22)11(14,15)12(16,17)13(18,19)20/h8-9H,3-7H2,1-2H3 |
| InChIKey | VXUBFGMXQOUTPN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|