C12H18F5NO3S — CID 90590227
2,2,3,3,3-pentafluoro-1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]propan-1-one (PubChem CID 90590227) has the molecular formula C12H18F5NO3S and a molecular weight of 351.34 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90590227 |
| Molecular Formula | C12H18F5NO3S |
| Molecular Weight | 351.34 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-[4-(2-methylpropylsulfonyl)piperidin-1-yl]propan-1-one |
| SMILES | CC(C)CS(=O)(=O)C1CCN(C(=O)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H18F5NO3S/c1-8(2)7-22(20,21)9-3-5-18(6-4-9)10(19)11(13,14)12(15,16)17/h8-9H,3-7H2,1-2H3 |
| InChIKey | GYXBVDVWFXTVSO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|