C19H24N2O3S — CID 90591018
2-(1-methylindol-3-yl)-1-(3-methylsulfonyl-8-azabicyclo[3.2.1]octan-8-yl)ethanone (PubChem CID 90591018) has the molecular formula C19H24N2O3S and a molecular weight of 360.48 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)-1-(3-methylsulfonyl-8-azabicyclo[3.2.1]octan-8-yl)ethanone.
| Compound Name | 2-(1-methylindol-3-yl)-1-(3-methylsulfonyl-8-azabicyclo[3.2.1]octan-8-yl)ethanone |
|---|---|
| PubChem CID | 90591018 |
| Molecular Formula | C19H24N2O3S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-(1-methylindol-3-yl)-1-(3-methylsulfonyl-8-azabicyclo[3.2.1]octan-8-yl)ethanone |
| SMILES | Cn1cc(CC(=O)N2C3CCC2CC(S(C)(=O)=O)C3)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O3S/c1-20-12-13(17-5-3-4-6-18(17)20)9-19(22)21-14-7-8-15(21)11-16(10-14)25(2,23)24/h3-6,12,14-16H,7-11H2,1-2H3 |
| InChIKey | ZZBYLZAKXKLYLZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 59.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |