About [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone
[4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 90592106) has the molecular formula C14H17N5O3S
and a molecular weight of 335.39 g/mol. Its IUPAC name is [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone.
Molecular Properties
| Compound Name | [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone |
| PubChem CID | 90592106 |
| Molecular Formula | C14H17N5O3S |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | Cn1cnnc1S(=O)(=O)C1CCN(C(=O)c2cccnc2)CC1 |
| InChI | InChI=1S/C14H17N5O3S/c1-18-10-16-17-14(18)23(21,22)12-4-7-19(8-5-12)13(20)11-3-2-6-15-9-11/h2-3,6,9-10,12H,4-5,7-8H2,1H3 |
| InChIKey | WMFSYBXCDVFKJO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone?
The IUPAC name of [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone (CID 90592106) is [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone.
What is the SMILES notation for [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone?
The canonical SMILES for [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone is Cn1cnnc1S(=O)(=O)C1CCN(C(=O)c2cccnc2)CC1.
What is the InChIKey of [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone?
The InChIKey is WMFSYBXCDVFKJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O3S/c1-18-10-16-17-14(18)23(21,22)12-4-7-19(8-5-12)13(20)11-3-2-6-15-9-11/h2-3,6,9-10,12H,4-5,7-8H2,1H3.
What are the key properties of [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone?
[4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone has a molecular weight of 335.39 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]piperidin-1-yl]-pyridin-3-ylmethanone is sourced from PubChem (CID 90592106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).