About 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine
4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine (PubChem CID 90592398) has the molecular formula C11H20N4O4S2
and a molecular weight of 336.44 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine.
Molecular Properties
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine |
| PubChem CID | 90592398 |
| Molecular Formula | C11H20N4O4S2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine |
| SMILES | CC(C)S(=O)(=O)N1CCC(S(=O)(=O)c2nncn2C)CC1 |
| InChI | InChI=1S/C11H20N4O4S2/c1-9(2)21(18,19)15-6-4-10(5-7-15)20(16,17)11-13-12-8-14(11)3/h8-10H,4-7H2,1-3H3 |
| InChIKey | YQCDSUDCRXRAFS-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 102.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine?
The IUPAC name of 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine (CID 90592398) is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine.
What is the SMILES notation for 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine?
The canonical SMILES for 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine is CC(C)S(=O)(=O)N1CCC(S(=O)(=O)c2nncn2C)CC1.
What is the InChIKey of 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine?
The InChIKey is YQCDSUDCRXRAFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O4S2/c1-9(2)21(18,19)15-6-4-10(5-7-15)20(16,17)11-13-12-8-14(11)3/h8-10H,4-7H2,1-3H3.
What are the key properties of 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine?
4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine has a molecular weight of 336.44 g/mol, XLogP of -0.21, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methyl-1,2,4-triazol-3-yl)sulfonyl]-1-propan-2-ylsulfonylpiperidine is sourced from PubChem (CID 90592398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).