C22H27N5O6S — CID 90592635
2-[1-[6-(2-methoxyethyl)-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl]piperidin-4-yl]sulfonyl-N-methylacetamide (PubChem CID 90592635) has the molecular formula C22H27N5O6S and a molecular weight of 489.55 g/mol. Its IUPAC name is 2-[1-[6-(2-methoxyethyl)-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl]piperidin-4-yl]sulfonyl-N-methylacetamide.
| Compound Name | 2-[1-[6-(2-methoxyethyl)-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl]piperidin-4-yl]sulfonyl-N-methylacetamide |
|---|---|
| PubChem CID | 90592635 |
| Molecular Formula | C22H27N5O6S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 2-[1-[6-(2-methoxyethyl)-2-oxo-1,6,8-triazatricyclo[7.4.0.03,7]trideca-3(7),4,8,10,12-pentaene-5-carbonyl]piperidin-4-yl]sulfonyl-N-methylacetamide |
| SMILES | CNC(=O)CS(=O)(=O)C1CCN(C(=O)c2cc3c(=O)n4ccccc4nc3n2CCOC)CC1 |
| InChI | InChI=1S/C22H27N5O6S/c1-23-19(28)14-34(31,32)15-6-9-25(10-7-15)22(30)17-13-16-20(26(17)11-12-33-2)24-18-5-3-4-8-27(18)21(16)29/h3-5,8,13,15H,6-7,9-12,14H2,1-2H3,(H,23,28) |
| InChIKey | LIQUFKGFLQAFQX-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 132.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |