C21H27N3O4S — CID 90593960
(3-cyclohexylsulfonylazetidin-1-yl)-[3-(3-methoxyphenyl)-1-methylpyrazol-5-yl]methanone (PubChem CID 90593960) has the molecular formula C21H27N3O4S and a molecular weight of 417.53 g/mol. Its IUPAC name is (3-cyclohexylsulfonylazetidin-1-yl)-[3-(3-methoxyphenyl)-1-methylpyrazol-5-yl]methanone.
| Compound Name | (3-cyclohexylsulfonylazetidin-1-yl)-[3-(3-methoxyphenyl)-1-methylpyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 90593960 |
| Molecular Formula | C21H27N3O4S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (3-cyclohexylsulfonylazetidin-1-yl)-[3-(3-methoxyphenyl)-1-methylpyrazol-5-yl]methanone |
| SMILES | COc1cccc(-c2cc(C(=O)N3CC(S(=O)(=O)C4CCCCC4)C3)n(C)n2)c1 |
| InChI | InChI=1S/C21H27N3O4S/c1-23-20(12-19(22-23)15-7-6-8-16(11-15)28-2)21(25)24-13-18(14-24)29(26,27)17-9-4-3-5-10-17/h6-8,11-12,17-18H,3-5,9-10,13-14H2,1-2H3 |
| InChIKey | XFGDIAJDHDQQFB-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |