C10H14F5NO3S — CID 90594298
2,2,3,3,3-pentafluoro-1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]propan-1-one (PubChem CID 90594298) has the molecular formula C10H14F5NO3S and a molecular weight of 323.28 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]propan-1-one.
| Compound Name | 2,2,3,3,3-pentafluoro-1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 90594298 |
| Molecular Formula | C10H14F5NO3S |
| Molecular Weight | 323.28 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-1-[3-(2-methylpropylsulfonyl)azetidin-1-yl]propan-1-one |
| SMILES | CC(C)CS(=O)(=O)C1CN(C(=O)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F5NO3S/c1-6(2)5-20(18,19)7-3-16(4-7)8(17)9(11,12)10(13,14)15/h6-7H,3-5H2,1-2H3 |
| InChIKey | YMRLZIXKNMHYKI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|